C15H22Cl2N6O — CID 119832832
5-methyl-N-(2-methyl-4-pyridinyl)-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119832832) has the molecular formula C15H22Cl2N6O and a molecular weight of 373.29 g/mol. Its IUPAC name is 5-methyl-N-(2-methyl-4-pyridinyl)-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | 5-methyl-N-(2-methyl-4-pyridinyl)-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119832832 |
| Molecular Formula | C15H22Cl2N6O |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-methyl-N-(2-methyl-4-pyridinyl)-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1cc(NC(=O)c2nnn(C3CCNCC3)c2C)ccn1.Cl.Cl |
| InChI | InChI=1S/C15H20N6O.2ClH/c1-10-9-12(3-8-17-10)18-15(22)14-11(2)21(20-19-14)13-4-6-16-7-5-13;;/h3,8-9,13,16H,4-7H2,1-2H3,(H,17,18,22);2*1H |
| InChIKey | FXAIHRCHZBIGKP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |