C16H20FN5O — CID 119674362
N-(3-fluoro-4-methylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119674362) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119674362 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nnn(C3CCNCC3)c2C)cc1F |
| InChI | InChI=1S/C16H20FN5O/c1-10-3-4-12(9-14(10)17)19-16(23)15-11(2)22(21-20-15)13-5-7-18-8-6-13/h3-4,9,13,18H,5-8H2,1-2H3,(H,19,23) |
| InChIKey | SBPJZTRLFIZBCU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |