C16H20FN5O2 — CID 119705669
N-(3-fluoro-4-methoxyphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119705669) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119705669 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nnn(C3CCNCC3)c2C)cc1F |
| InChI | InChI=1S/C16H20FN5O2/c1-10-15(20-21-22(10)12-5-7-18-8-6-12)16(23)19-11-3-4-14(24-2)13(17)9-11/h3-4,9,12,18H,5-8H2,1-2H3,(H,19,23) |
| InChIKey | RSLIGBFTFBNTMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |