C16H17F4N5O — CID 119709833
N-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119709833) has the molecular formula C16H17F4N5O and a molecular weight of 371.34 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119709833 |
| Molecular Formula | C16H17F4N5O |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)c(C(F)(F)F)c2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C16H17F4N5O/c1-9-14(23-24-25(9)11-4-6-21-7-5-11)15(26)22-10-2-3-13(17)12(8-10)16(18,19)20/h2-3,8,11,21H,4-7H2,1H3,(H,22,26) |
| InChIKey | HSCUWLQOWINSNC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |