C15H16F3N5O — CID 119708593
5-methyl-1-piperidin-4-yl-N-(2,4,5-trifluorophenyl)triazole-4-carboxamide (PubChem CID 119708593) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-(2,4,5-trifluorophenyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-(2,4,5-trifluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119708593 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-(2,4,5-trifluorophenyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(F)c(F)cc2F)nnn1C1CCNCC1 |
| InChI | InChI=1S/C15H16F3N5O/c1-8-14(21-22-23(8)9-2-4-19-5-3-9)15(24)20-13-7-11(17)10(16)6-12(13)18/h6-7,9,19H,2-5H2,1H3,(H,20,24) |
| InChIKey | XXHOMHYZXNZVTR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|