C19H27N7O — CID 119841519
5-methyl-1-piperidin-4-yl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]triazole-4-carboxamide (PubChem CID 119841519) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119841519 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccnc(N3CCCC3)c2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C19H27N7O/c1-14-18(23-24-26(14)16-5-7-20-8-6-16)19(27)22-13-15-4-9-21-17(12-15)25-10-2-3-11-25/h4,9,12,16,20H,2-3,5-8,10-11,13H2,1H3,(H,22,27) |
| InChIKey | KHWBTSLHBTWPAB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |