C12H16F3N5O2 — CID 119708105
N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-3-carboxamide (PubChem CID 119708105) has the molecular formula C12H16F3N5O2 and a molecular weight of 319.29 g/mol. Its IUPAC name is N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-3-carboxamide.
| Compound Name | N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119708105 |
| Molecular Formula | C12H16F3N5O2 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]morpholine-3-carboxamide |
| SMILES | O=C(NCCNc1nccc(C(F)(F)F)n1)C1COCCN1 |
| InChI | InChI=1S/C12H16F3N5O2/c13-12(14,15)9-1-2-18-11(20-9)19-4-3-17-10(21)8-7-22-6-5-16-8/h1-2,8,16H,3-7H2,(H,17,21)(H,18,19,20) |
| InChIKey | JGDMAUURRDZELU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|