C18H27ClN4O2 — CID 118775045
4-[2-(azepan-1-yl)ethylcarbamoylamino]-2-chloro-N-ethylbenzamide (PubChem CID 118775045) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)ethylcarbamoylamino]-2-chloro-N-ethylbenzamide.
| Compound Name | 4-[2-(azepan-1-yl)ethylcarbamoylamino]-2-chloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 118775045 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[2-(azepan-1-yl)ethylcarbamoylamino]-2-chloro-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)NCCN2CCCCCC2)cc1Cl |
| InChI | InChI=1S/C18H27ClN4O2/c1-2-20-17(24)15-8-7-14(13-16(15)19)22-18(25)21-9-12-23-10-5-3-4-6-11-23/h7-8,13H,2-6,9-12H2,1H3,(H,20,24)(H2,21,22,25) |
| InChIKey | KNKPALOSODTKEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |