C24H26FN3OS — CID 55756710
N-[3-[benzyl(methyl)amino]propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 55756710) has the molecular formula C24H26FN3OS and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55756710 |
| Molecular Formula | C24H26FN3OS |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | CN(CCCNC(=O)c1cccnc1SCc1ccc(F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26FN3OS/c1-28(17-19-7-3-2-4-8-19)16-6-15-26-23(29)22-9-5-14-27-24(22)30-18-20-10-12-21(25)13-11-20/h2-5,7-14H,6,15-18H2,1H3,(H,26,29) |
| InChIKey | GVLRUHRRFLUUKN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|