C20H16BrFN2OS — CID 16719157
2-[(3-bromophenyl)methylsulfanyl]-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 16719157) has the molecular formula C20H16BrFN2OS and a molecular weight of 431.33 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16719157 |
| Molecular Formula | C20H16BrFN2OS |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[(4-fluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cccnc1SCc1cccc(Br)c1 |
| InChI | InChI=1S/C20H16BrFN2OS/c21-16-4-1-3-15(11-16)13-26-20-18(5-2-10-23-20)19(25)24-12-14-6-8-17(22)9-7-14/h1-11H,12-13H2,(H,24,25) |
| InChIKey | UDCYGPKQYMJBFC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |