C21H20FN3OS — CID 67521454
2-[3-(4-fluorophenyl)propylsulfanyl]-N-(pyridin-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 67521454) has the molecular formula C21H20FN3OS and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propylsulfanyl]-N-(pyridin-4-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-(pyridin-4-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67521454 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-N-(pyridin-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cccnc1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3OS/c22-18-7-5-16(6-8-18)3-2-14-27-21-19(4-1-11-24-21)20(26)25-15-17-9-12-23-13-10-17/h1,4-13H,2-3,14-15H2,(H,25,26) |
| InChIKey | YEZBLFZTIAFZTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|