C20H18ClFN2OS2 — CID 46909311
N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide (PubChem CID 46909311) has the molecular formula C20H18ClFN2OS2 and a molecular weight of 420.96 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46909311 |
| Molecular Formula | C20H18ClFN2OS2 |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(4-fluorophenyl)propylsulfanyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1cccnc1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18ClFN2OS2/c21-18-10-9-16(27-18)13-24-19(25)17-4-1-11-23-20(17)26-12-2-3-14-5-7-15(22)8-6-14/h1,4-11H,2-3,12-13H2,(H,24,25) |
| InChIKey | BZCVSOOVCHANQN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|