C15H14ClFN2OS — CID 26635822
2-chloro-N-[3-(4-fluorophenyl)sulfanylpropyl]pyridine-3-carboxamide (PubChem CID 26635822) has the molecular formula C15H14ClFN2OS and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-fluorophenyl)sulfanylpropyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[3-(4-fluorophenyl)sulfanylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26635822 |
| Molecular Formula | C15H14ClFN2OS |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-chloro-N-[3-(4-fluorophenyl)sulfanylpropyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)c1cccnc1Cl |
| InChI | InChI=1S/C15H14ClFN2OS/c16-14-13(3-1-8-18-14)15(20)19-9-2-10-21-12-6-4-11(17)5-7-12/h1,3-8H,2,9-10H2,(H,19,20) |
| InChIKey | GPPOIKCSCBCXCO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|