C21H21FN2OS2 — CID 59487303
2-[3-(4-fluorophenyl)propylsulfanyl]-4-methyl-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 59487303) has the molecular formula C21H21FN2OS2 and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propylsulfanyl]-4-methyl-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-4-methyl-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59487303 |
| Molecular Formula | C21H21FN2OS2 |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-4-methyl-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccnc(SCCCc2ccc(F)cc2)c1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C21H21FN2OS2/c1-15-10-11-23-21(19(15)20(25)24-14-18-5-3-12-26-18)27-13-2-4-16-6-8-17(22)9-7-16/h3,5-12H,2,4,13-14H2,1H3,(H,24,25) |
| InChIKey | AXBPVPWMSFZTKH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|