C19H18N2O2S3 — CID 68727895
2-[2-(benzenesulfinyl)ethylsulfanyl]-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 68727895) has the molecular formula C19H18N2O2S3 and a molecular weight of 402.57 g/mol. Its IUPAC name is 2-[2-(benzenesulfinyl)ethylsulfanyl]-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfinyl)ethylsulfanyl]-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68727895 |
| Molecular Formula | C19H18N2O2S3 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[2-(benzenesulfinyl)ethylsulfanyl]-N-(thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cccnc1SCCS(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S3/c22-18(21-14-15-6-5-11-24-15)17-9-4-10-20-19(17)25-12-13-26(23)16-7-2-1-3-8-16/h1-11H,12-14H2,(H,21,22) |
| InChIKey | CLIOLRWSBSPQAK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |