C20H20N2O3S3 — CID 68729638
2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide (PubChem CID 68729638) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68729638 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cccnc1SCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S3/c23-19(21-12-10-16-6-5-13-26-16)18-9-4-11-22-20(18)27-14-15-28(24,25)17-7-2-1-3-8-17/h1-9,11,13H,10,12,14-15H2,(H,21,23) |
| InChIKey | JVKDRNDHYOLDHR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |