C18H20N2O3S2 — CID 25221972
2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclopropylmethyl)pyridine-3-carboxamide (PubChem CID 25221972) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclopropylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclopropylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25221972 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclopropylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CC1)c1cccnc1SCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S2/c21-17(20-13-14-8-9-14)16-7-4-10-19-18(16)24-11-12-25(22,23)15-5-2-1-3-6-15/h1-7,10,14H,8-9,11-13H2,(H,20,21) |
| InChIKey | AWZCSIAJVYDQOL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |