C22H28N2O3S2 — CID 25221746
2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(1R)-1-cyclohexylethyl]pyridine-3-carboxamide (PubChem CID 25221746) has the molecular formula C22H28N2O3S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(1R)-1-cyclohexylethyl]pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(1R)-1-cyclohexylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25221746 |
| Molecular Formula | C22H28N2O3S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[(1R)-1-cyclohexylethyl]pyridine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cccnc1SCCS(=O)(=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H28N2O3S2/c1-17(18-9-4-2-5-10-18)24-21(25)20-13-8-14-23-22(20)28-15-16-29(26,27)19-11-6-3-7-12-19/h3,6-8,11-14,17-18H,2,4-5,9-10,15-16H2,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | SANWQZQAHYLMPB-QGZVFWFLSA-N |
| XLogP | 4.35 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |