C21H26N2O3S2 — CID 25221518
2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclohexylmethyl)pyridine-3-carboxamide (PubChem CID 25221518) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclohexylmethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclohexylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25221518 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-(cyclohexylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cccnc1SCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S2/c24-20(23-16-17-8-3-1-4-9-17)19-12-7-13-22-21(19)27-14-15-28(25,26)18-10-5-2-6-11-18/h2,5-7,10-13,17H,1,3-4,8-9,14-16H2,(H,23,24) |
| InChIKey | RNUJWNCCAFNGFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |