C22H21BrN2O3S2 — CID 91053881
2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[2-(4-bromophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 91053881) has the molecular formula C22H21BrN2O3S2 and a molecular weight of 505.46 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[2-(4-bromophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[2-(4-bromophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91053881 |
| Molecular Formula | C22H21BrN2O3S2 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethylsulfanyl]-N-[2-(4-bromophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(Br)cc1)c1cccnc1SCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21BrN2O3S2/c23-18-10-8-17(9-11-18)12-14-24-21(26)20-7-4-13-25-22(20)29-15-16-30(27,28)19-5-2-1-3-6-19/h1-11,13H,12,14-16H2,(H,24,26) |
| InChIKey | XSSMWDZLUPSSLY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |