C21H19F3N2OS2 — CID 46908823
N-(thiophen-2-ylmethyl)-2-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]pyridine-3-carboxamide (PubChem CID 46908823) has the molecular formula C21H19F3N2OS2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-2-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]pyridine-3-carboxamide.
| Compound Name | N-(thiophen-2-ylmethyl)-2-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46908823 |
| Molecular Formula | C21H19F3N2OS2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-2-[3-[3-(trifluoromethyl)phenyl]sulfanylpropyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cccnc1CCCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N2OS2/c22-21(23,24)15-5-1-6-16(13-15)28-12-4-9-19-18(8-2-10-25-19)20(27)26-14-17-7-3-11-29-17/h1-3,5-8,10-11,13H,4,9,12,14H2,(H,26,27) |
| InChIKey | FJZAZDHVKPQPKB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|