C19H16FN3OS — CID 60543467
2-[(4-fluorophenyl)methylsulfanyl]-N-(5-methyl-2-pyridinyl)pyridine-3-carboxamide (PubChem CID 60543467) has the molecular formula C19H16FN3OS and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-(5-methyl-2-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-(5-methyl-2-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60543467 |
| Molecular Formula | C19H16FN3OS |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-(5-methyl-2-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cccnc2SCc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C19H16FN3OS/c1-13-4-9-17(22-11-13)23-18(24)16-3-2-10-21-19(16)25-12-14-5-7-15(20)8-6-14/h2-11H,12H2,1H3,(H,22,23,24) |
| InChIKey | POHLNGJQWVHVQX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |