C21H17FN4OS — CID 75397989
2-[(4-fluorophenyl)methylsulfanyl]-N-(3-methyl-2H-indazol-6-yl)pyridine-3-carboxamide (PubChem CID 75397989) has the molecular formula C21H17FN4OS and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-(3-methyl-2H-indazol-6-yl)pyridine-3-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-(3-methyl-2H-indazol-6-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75397989 |
| Molecular Formula | C21H17FN4OS |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-(3-methyl-2H-indazol-6-yl)pyridine-3-carboxamide |
| SMILES | Cc1[nH]nc2cc(NC(=O)c3cccnc3SCc3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C21H17FN4OS/c1-13-17-9-8-16(11-19(17)26-25-13)24-20(27)18-3-2-10-23-21(18)28-12-14-4-6-15(22)7-5-14/h2-11H,12H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | NYCBJHHWCXUPCN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |