C21H17ClFN3O2S — CID 55917121
N-(5-acetamido-2-chlorophenyl)-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide (PubChem CID 55917121) has the molecular formula C21H17ClFN3O2S and a molecular weight of 429.90 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55917121 |
| Molecular Formula | C21H17ClFN3O2S |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-2-[(4-fluorophenyl)methylsulfanyl]pyridine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)c2cccnc2SCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H17ClFN3O2S/c1-13(27)25-16-8-9-18(22)19(11-16)26-20(28)17-3-2-10-24-21(17)29-12-14-4-6-15(23)7-5-14/h2-11H,12H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | BZHWWACMRRTVCH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |