C22H26FN3OS — CID 55761553
(4-cyclopentylpiperazin-1-yl)-[2-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]methanone (PubChem CID 55761553) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[2-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[2-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 55761553 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[2-[(4-fluorophenyl)methylsulfanyl]-3-pyridinyl]methanone |
| SMILES | O=C(c1cccnc1SCc1ccc(F)cc1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C22H26FN3OS/c23-18-9-7-17(8-10-18)16-28-21-20(6-3-11-24-21)22(27)26-14-12-25(13-15-26)19-4-1-2-5-19/h3,6-11,19H,1-2,4-5,12-16H2 |
| InChIKey | MLKYMSRWPIPGLJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |