C16H19ClF3N3O5S — CID 55669392
1-[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 55669392) has the molecular formula C16H19ClF3N3O5S and a molecular weight of 457.86 g/mol. Its IUPAC name is 1-[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55669392 |
| Molecular Formula | C16H19ClF3N3O5S |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 1-[4-chloro-3-[methoxy(methyl)sulfamoyl]benzoyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)N2CCCC2C(=O)NCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H19ClF3N3O5S/c1-22(28-2)29(26,27)13-8-10(5-6-11(13)17)15(25)23-7-3-4-12(23)14(24)21-9-16(18,19)20/h5-6,8,12H,3-4,7,9H2,1-2H3,(H,21,24) |
| InChIKey | BKFKMAGAOBRGLV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|