C17H20ClN3O4S2 — CID 56533013
2-chloro-N-methoxy-N-methyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 56533013) has the molecular formula C17H20ClN3O4S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 2-chloro-N-methoxy-N-methyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-methoxy-N-methyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56533013 |
| Molecular Formula | C17H20ClN3O4S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-chloro-N-methoxy-N-methyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)N2CCCC(c3nccs3)C2)ccc1Cl |
| InChI | InChI=1S/C17H20ClN3O4S2/c1-20(25-2)27(23,24)15-10-12(5-6-14(15)18)17(22)21-8-3-4-13(11-21)16-19-7-9-26-16/h5-7,9-10,13H,3-4,8,11H2,1-2H3 |
| InChIKey | LDYVNBBOZRQYBM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|