C20H21Cl2N3O2 — CID 43926199
N-(2-carbamoylphenyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43926199) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43926199 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(2-carbamoylphenyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C1CCCN(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-16-8-7-13(10-17(16)22)11-25-9-3-4-14(12-25)20(27)24-18-6-2-1-5-15(18)19(23)26/h1-2,5-8,10,14H,3-4,9,11-12H2,(H2,23,26)(H,24,27) |
| InChIKey | SILJQDGQDGVHHA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |