C8H5F5O5Si — CID 90170337
[difluoro(trihydroxysilyl)methyl] 2,3,4-trifluorobenzoate (PubChem CID 90170337) has the molecular formula C8H5F5O5Si and a molecular weight of 304.20 g/mol. Its IUPAC name is [difluoro(trihydroxysilyl)methyl] 2,3,4-trifluorobenzoate.
| Compound Name | [difluoro(trihydroxysilyl)methyl] 2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 90170337 |
| Molecular Formula | C8H5F5O5Si |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | [difluoro(trihydroxysilyl)methyl] 2,3,4-trifluorobenzoate |
| SMILES | O=C(OC(F)(F)[Si](O)(O)O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H5F5O5Si/c9-4-2-1-3(5(10)6(4)11)7(14)18-8(12,13)19(15,16)17/h1-2,15-17H |
| InChIKey | DYWQGTKQTVVZGJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|