About (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate
(2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate (PubChem CID 67114839) has the molecular formula C14H21NO6
and a molecular weight of 299.32 g/mol. Its IUPAC name is (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate |
| PubChem CID | 67114839 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate |
| SMILES | CC(C)C(CO)(C(=O)Oc1ccccc1O)N(CO)CO |
| InChI | InChI=1S/C14H21NO6/c1-10(2)14(7-16,15(8-17)9-18)13(20)21-12-6-4-3-5-11(12)19/h3-6,10,16-19H,7-9H2,1-2H3 |
| InChIKey | LUIHGRZDKDZYHY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate?
The IUPAC name of (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate (CID 67114839) is (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate.
What is the SMILES notation for (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate?
The canonical SMILES for (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate is CC(C)C(CO)(C(=O)Oc1ccccc1O)N(CO)CO.
What is the InChIKey of (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate?
The InChIKey is LUIHGRZDKDZYHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO6/c1-10(2)14(7-16,15(8-17)9-18)13(20)21-12-6-4-3-5-11(12)19/h3-6,10,16-19H,7-9H2,1-2H3.
What are the key properties of (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate?
(2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate has a molecular weight of 299.32 g/mol, XLogP of -0.11, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl) 2-[bis(hydroxymethyl)amino]-2-(hydroxymethyl)-3-methylbutanoate is sourced from PubChem (CID 67114839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).