C13H17BN2O4 — CID 114528534
[5-methoxy-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boronic acid (PubChem CID 114528534) has the molecular formula C13H17BN2O4 and a molecular weight of 276.10 g/mol. Its IUPAC name is [5-methoxy-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [5-methoxy-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 114528534 |
| Molecular Formula | C13H17BN2O4 |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [5-methoxy-2-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]boronic acid |
| SMILES | COc1ccc(OCCc2nccn2C)c(B(O)O)c1 |
| InChI | InChI=1S/C13H17BN2O4/c1-16-7-6-15-13(16)5-8-20-12-4-3-10(19-2)9-11(12)14(17)18/h3-4,6-7,9,17-18H,5,8H2,1-2H3 |
| InChIKey | ARANPKDSSJRONK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|