C11H15BrClN — CID 170866064
3-(5-bromo-2-chlorophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 170866064) has the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. Its IUPAC name is 3-(5-bromo-2-chlorophenyl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-bromo-2-chlorophenyl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170866064 |
| Molecular Formula | C11H15BrClN |
| Molecular Weight | 276.60 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 3-(5-bromo-2-chlorophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H15BrClN/c1-14(2)7-3-4-9-8-10(12)5-6-11(9)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | PYOSDMHJRPTZOK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |