C36H63N5O15 — CID 102282602
6-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 102282602) has the molecular formula C36H63N5O15 and a molecular weight of 805.92 g/mol. Its IUPAC name is 6-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 102282602 |
| Molecular Formula | C36H63N5O15 |
| Molecular Weight | 805.92 g/mol |
| Exact Mass | 805.43 |
| IUPAC Name | 6-[3,4,5-tris[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COCCOCCOCCOCCOc1cc(-c2nc(N)nc(N)n2)cc(OCCOCCOCCOCCOC)c1OCCOCCOCCOCCOC |
| InChI | InChI=1S/C36H63N5O15/c1-42-4-7-45-10-13-48-16-19-51-22-25-54-31-28-30(34-39-35(37)41-36(38)40-34)29-32(55-26-23-52-20-17-49-14-11-46-8-5-43-2)33(31)56-27-24-53-21-18-50-15-12-47-9-6-44-3/h28-29H,4-27H2,1-3H3,(H4,37,38,39,40,41) |
| InChIKey | ADXCUAUVHQOUIT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 229.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.92 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|