C27H45N5O10 — CID 177461008
6-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 177461008) has the molecular formula C27H45N5O10 and a molecular weight of 599.68 g/mol. Its IUPAC name is 6-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 177461008 |
| Molecular Formula | C27H45N5O10 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 6-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COCCOCCOCCOCCOc1ccc(-c2nc(N)nc(N)n2)cc1OCCOCCOCCOCCOC |
| InChI | InChI=1S/C27H45N5O10/c1-33-5-7-35-9-11-37-13-15-39-17-19-41-23-4-3-22(25-30-26(28)32-27(29)31-25)21-24(23)42-20-18-40-16-14-38-12-10-36-8-6-34-2/h3-4,21H,5-20H2,1-2H3,(H4,28,29,30,31,32) |
| InChIKey | GOZCNDUWXBALOR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 183.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|