C19H21FO6 — CID 146330939
[4-[3,4-bis(2-methoxyethoxy)phenyl]-2-fluorophenyl] formate (PubChem CID 146330939) has the molecular formula C19H21FO6 and a molecular weight of 364.37 g/mol. Its IUPAC name is [4-[3,4-bis(2-methoxyethoxy)phenyl]-2-fluorophenyl] formate.
| Compound Name | [4-[3,4-bis(2-methoxyethoxy)phenyl]-2-fluorophenyl] formate |
|---|---|
| PubChem CID | 146330939 |
| Molecular Formula | C19H21FO6 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [4-[3,4-bis(2-methoxyethoxy)phenyl]-2-fluorophenyl] formate |
| SMILES | COCCOc1ccc(-c2ccc(OC=O)c(F)c2)cc1OCCOC |
| InChI | InChI=1S/C19H21FO6/c1-22-7-9-24-18-6-4-15(12-19(18)25-10-8-23-2)14-3-5-17(26-13-21)16(20)11-14/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | JBYDBJMMVREREN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|