C17H15F3O3 — CID 172651121
1-[4-(2-methoxyethoxy)-3-(3,4,5-trifluorophenyl)phenyl]ethanone (PubChem CID 172651121) has the molecular formula C17H15F3O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)-3-(3,4,5-trifluorophenyl)phenyl]ethanone.
| Compound Name | 1-[4-(2-methoxyethoxy)-3-(3,4,5-trifluorophenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 172651121 |
| Molecular Formula | C17H15F3O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)-3-(3,4,5-trifluorophenyl)phenyl]ethanone |
| SMILES | COCCOc1ccc(C(C)=O)cc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H15F3O3/c1-10(21)11-3-4-16(23-6-5-22-2)13(7-11)12-8-14(18)17(20)15(19)9-12/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | HFQLOSUXDSVUKX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|