C20H20F2O6 — CID 126574853
methyl 4-[2,3-difluoro-6-[2-(2-methoxyethoxy)ethoxy]benzoyl]benzoate (PubChem CID 126574853) has the molecular formula C20H20F2O6 and a molecular weight of 394.37 g/mol. Its IUPAC name is methyl 4-[2,3-difluoro-6-[2-(2-methoxyethoxy)ethoxy]benzoyl]benzoate.
| Compound Name | methyl 4-[2,3-difluoro-6-[2-(2-methoxyethoxy)ethoxy]benzoyl]benzoate |
|---|---|
| PubChem CID | 126574853 |
| Molecular Formula | C20H20F2O6 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | methyl 4-[2,3-difluoro-6-[2-(2-methoxyethoxy)ethoxy]benzoyl]benzoate |
| SMILES | COCCOCCOc1ccc(F)c(F)c1C(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H20F2O6/c1-25-9-10-27-11-12-28-16-8-7-15(21)18(22)17(16)19(23)13-3-5-14(6-4-13)20(24)26-2/h3-8H,9-12H2,1-2H3 |
| InChIKey | XDOQCFNADNSZIU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|