C22H32BN5O9S — CID 169195735
CID 169195735 (PubChem CID 169195735) has the molecular formula C22H32BN5O9S and a molecular weight of 553.40 g/mol.
| Compound Name | CID 169195735 |
|---|---|
| PubChem CID | 169195735 |
| Molecular Formula | C22H32BN5O9S |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)OCCOCCNSNC(=O)OC)C(C)C)cc1 |
| InChI | InChI=1S/C22H32BN5O9S/c1-14(2)18(27-21(32)36-11-10-35-9-8-25-38-28-22(33)34-3)19(30)24-12-17(29)26-16-6-4-15(5-7-16)13-37-20(23)31/h4-7,14,18,25H,8-13H2,1-3H3,(H,24,30)(H,26,29)(H,27,32)(H,28,33) |
| InChIKey | KXRTYEHNXJSTKC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 182.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|