C29H51BN6O7 — CID 163384887
CID 163384887 (PubChem CID 163384887) has the molecular formula C29H51BN6O7 and a molecular weight of 606.57 g/mol.
| Compound Name | CID 163384887 |
|---|---|
| PubChem CID | 163384887 |
| Molecular Formula | C29H51BN6O7 |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | — |
| SMILES | CC(C)C(C=O)NC(=O)CC(C)(C)OCC(C)(C)N.CCCNC(N)=O.[B]C(=O)OCc1ccc(NC(=O)CNC)cc1 |
| InChI | InChI=1S/C14H28N2O3.C11H13BN2O3.C4H10N2O/c1-10(2)11(8-17)16-12(18)7-14(5,6)19-9-13(3,4)15;1-13-6-10(15)14-9-4-2-8(3-5-9)7-17-11(12)16;1-2-3-6-4(5)7/h8,10-11H,7,9,15H2,1-6H3,(H,16,18);2-5,13H,6-7H2,1H3,(H,14,15);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | OTBINHNTHPTPCX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 203.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|