C37H65N5O7 — CID 167483748
[4-[[2-[[3-methyl-2-[[2,2,4,4,6-pentamethyl-6-(3-methylbutoxy)heptanoyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate;propylurea (PubChem CID 167483748) has the molecular formula C37H65N5O7 and a molecular weight of 691.96 g/mol. Its IUPAC name is [4-[[2-[[3-methyl-2-[[2,2,4,4,6-pentamethyl-6-(3-methylbutoxy)heptanoyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate;propylurea.
| Compound Name | [4-[[2-[[3-methyl-2-[[2,2,4,4,6-pentamethyl-6-(3-methylbutoxy)heptanoyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate;propylurea |
|---|---|
| PubChem CID | 167483748 |
| Molecular Formula | C37H65N5O7 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.49 |
| IUPAC Name | [4-[[2-[[3-methyl-2-[[2,2,4,4,6-pentamethyl-6-(3-methylbutoxy)heptanoyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate;propylurea |
| SMILES | CC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)C(C)(C)CC(C)(C)CC(C)(C)OCCC(C)C)C(C)C)cc1.CCCNC(N)=O |
| InChI | InChI=1S/C33H55N3O6.C4H10N2O/c1-22(2)16-17-42-33(10,11)21-31(6,7)20-32(8,9)30(40)36-28(23(3)4)29(39)34-18-27(38)35-26-14-12-25(13-15-26)19-41-24(5)37;1-2-3-6-4(5)7/h12-15,22-23,28H,16-21H2,1-11H3,(H,34,39)(H,35,38)(H,36,40);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | LLYUZDJHHFLDIC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |