C19H29BrN2O3 — CID 142243952
N-[2-[4-(bromomethyl)anilino]-2-oxoethyl]-3-methyl-3-(3-methylbutoxy)butanamide (PubChem CID 142243952) has the molecular formula C19H29BrN2O3 and a molecular weight of 413.36 g/mol. Its IUPAC name is N-[2-[4-(bromomethyl)anilino]-2-oxoethyl]-3-methyl-3-(3-methylbutoxy)butanamide.
| Compound Name | N-[2-[4-(bromomethyl)anilino]-2-oxoethyl]-3-methyl-3-(3-methylbutoxy)butanamide |
|---|---|
| PubChem CID | 142243952 |
| Molecular Formula | C19H29BrN2O3 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[2-[4-(bromomethyl)anilino]-2-oxoethyl]-3-methyl-3-(3-methylbutoxy)butanamide |
| SMILES | CC(C)CCOC(C)(C)CC(=O)NCC(=O)Nc1ccc(CBr)cc1 |
| InChI | InChI=1S/C19H29BrN2O3/c1-14(2)9-10-25-19(3,4)11-17(23)21-13-18(24)22-16-7-5-15(12-20)6-8-16/h5-8,14H,9-13H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | WGPNGZGOCIMPLK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|