C22H35BrN2O3 — CID 142243933
N-[4-(bromomethyl)phenyl]-2-[[3-methyl-3-(3-methylbutoxy)butanoyl]amino]pentanamide (PubChem CID 142243933) has the molecular formula C22H35BrN2O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[4-(bromomethyl)phenyl]-2-[[3-methyl-3-(3-methylbutoxy)butanoyl]amino]pentanamide.
| Compound Name | N-[4-(bromomethyl)phenyl]-2-[[3-methyl-3-(3-methylbutoxy)butanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 142243933 |
| Molecular Formula | C22H35BrN2O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[4-(bromomethyl)phenyl]-2-[[3-methyl-3-(3-methylbutoxy)butanoyl]amino]pentanamide |
| SMILES | CCCC(NC(=O)CC(C)(C)OCCC(C)C)C(=O)Nc1ccc(CBr)cc1 |
| InChI | InChI=1S/C22H35BrN2O3/c1-6-7-19(21(27)24-18-10-8-17(15-23)9-11-18)25-20(26)14-22(4,5)28-13-12-16(2)3/h8-11,16,19H,6-7,12-15H2,1-5H3,(H,24,27)(H,25,26) |
| InChIKey | VIGQRMUDVNGNOR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|