C31H33N5O10 — CID 121383882
[4-[[2-[[1-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 121383882) has the molecular formula C31H33N5O10 and a molecular weight of 635.63 g/mol. Its IUPAC name is [4-[[2-[[1-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[2-[[1-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 121383882 |
| Molecular Formula | C31H33N5O10 |
| Molecular Weight | 635.63 g/mol |
| Exact Mass | 635.22 |
| IUPAC Name | [4-[[2-[[1-[5-(2,5-dioxopyrrol-1-yl)pentylcarbamoyl]cyclobutanecarbonyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | O=C(CNC(=O)C1(C(=O)NCCCCCN2C(=O)C=CC2=O)CCC1)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H33N5O10/c37-25(34-22-7-5-21(6-8-22)20-45-30(42)46-24-11-9-23(10-12-24)36(43)44)19-33-29(41)31(15-4-16-31)28(40)32-17-2-1-3-18-35-26(38)13-14-27(35)39/h5-14H,1-4,15-20H2,(H,32,40)(H,33,41)(H,34,37) |
| InChIKey | ZDPPJIUSKUHDDD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 203.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|