C34H52N4O6 — CID 171833856
1-N'-[2-[4-(2-ethyl-4-oxohexyl)anilino]-2-oxoethyl]-1-N-[5-(5-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-1-yl)pentyl]cyclobutane-1,1-dicarboxamide (PubChem CID 171833856) has the molecular formula C34H52N4O6 and a molecular weight of 612.81 g/mol. Its IUPAC name is 1-N'-[2-[4-(2-ethyl-4-oxohexyl)anilino]-2-oxoethyl]-1-N-[5-(5-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-1-yl)pentyl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-[4-(2-ethyl-4-oxohexyl)anilino]-2-oxoethyl]-1-N-[5-(5-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-1-yl)pentyl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 171833856 |
| Molecular Formula | C34H52N4O6 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | 1-N'-[2-[4-(2-ethyl-4-oxohexyl)anilino]-2-oxoethyl]-1-N-[5-(5-hydroxy-2-oxo-3-propan-2-ylpyrrolidin-1-yl)pentyl]cyclobutane-1,1-dicarboxamide |
| SMILES | CCC(=O)CC(CC)Cc1ccc(NC(=O)CNC(=O)C2(C(=O)NCCCCCN3C(=O)C(C(C)C)CC3O)CCC2)cc1 |
| InChI | InChI=1S/C34H52N4O6/c1-5-24(20-27(39)6-2)19-25-11-13-26(14-12-25)37-29(40)22-36-33(44)34(15-10-16-34)32(43)35-17-8-7-9-18-38-30(41)21-28(23(3)4)31(38)42/h11-14,23-24,28,30,41H,5-10,15-22H2,1-4H3,(H,35,43)(H,36,44)(H,37,40) |
| InChIKey | VKGOQZZXTKUQLR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|