C28H33N5O6S — CID 122577457
benzyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate (PubChem CID 122577457) has the molecular formula C28H33N5O6S and a molecular weight of 567.67 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 122577457 |
| Molecular Formula | C28H33N5O6S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
| SMILES | NC(=O)NCCC[C@H](NC(=O)[C@H](Cc1cccs1)NC(=O)OCc1ccccc1)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C28H33N5O6S/c29-27(37)30-14-4-9-23(25(35)31-21-12-10-19(17-34)11-13-21)32-26(36)24(16-22-8-5-15-40-22)33-28(38)39-18-20-6-2-1-3-7-20/h1-3,5-8,10-13,15,23-24,34H,4,9,14,16-18H2,(H,31,35)(H,32,36)(H,33,38)(H3,29,30,37)/t23-,24-/m0/s1 |
| InChIKey | NWCZKWOCPHRWRT-ZEQRLZLVSA-N |
| XLogP | 2.65 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|