C31H39N7O5 — CID 144870706
benzyl N-[(Z)-3-amino-4-[amino-[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-phenylbut-3-en-2-yl]carbamate (PubChem CID 144870706) has the molecular formula C31H39N7O5 and a molecular weight of 589.70 g/mol. Its IUPAC name is benzyl N-[(Z)-3-amino-4-[amino-[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-phenylbut-3-en-2-yl]carbamate.
| Compound Name | benzyl N-[(Z)-3-amino-4-[amino-[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-phenylbut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 144870706 |
| Molecular Formula | C31H39N7O5 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | benzyl N-[(Z)-3-amino-4-[amino-[5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-1-phenylbut-3-en-2-yl]carbamate |
| SMILES | NC(=O)NCCCC(C(=O)Nc1ccc(CO)cc1)N(N)/C=C(\N)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H39N7O5/c32-26(27(18-22-8-3-1-4-9-22)37-31(42)43-21-24-10-5-2-6-11-24)19-38(34)28(12-7-17-35-30(33)41)29(40)36-25-15-13-23(20-39)14-16-25/h1-6,8-11,13-16,19,27-28,39H,7,12,17-18,20-21,32,34H2,(H,36,40)(H,37,42)(H3,33,35,41)/b26-19- |
| InChIKey | LABWZOFMAVPHEE-XHPQRKPJSA-N |
| XLogP | 2.45 |
| TPSA | 198.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|