C32H36N6O5 — CID 158152091
benzyl (3R)-3-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-4-phenylbutanoate (PubChem CID 158152091) has the molecular formula C32H36N6O5 and a molecular weight of 584.68 g/mol. Its IUPAC name is benzyl (3R)-3-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-4-phenylbutanoate.
| Compound Name | benzyl (3R)-3-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 158152091 |
| Molecular Formula | C32H36N6O5 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | benzyl (3R)-3-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-4-phenylbutanoate |
| SMILES | NC(=O)NCCC[C@@H](C(=O)Nc1ccc(CO)cc1)n1cc([C@@H](CC(=O)OCc2ccccc2)Cc2ccccc2)nn1 |
| InChI | InChI=1S/C32H36N6O5/c33-32(42)34-17-7-12-29(31(41)35-27-15-13-24(21-39)14-16-27)38-20-28(36-37-38)26(18-23-8-3-1-4-9-23)19-30(40)43-22-25-10-5-2-6-11-25/h1-6,8-11,13-16,20,26,29,39H,7,12,17-19,21-22H2,(H,35,41)(H3,33,34,42)/t26-,29+/m1/s1 |
| InChIKey | QLHNOIJZINWRBM-UHSQPCAPSA-N |
| XLogP | 3.86 |
| TPSA | 161.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|