C23H36N6O3S — CID 123582866
6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-methyl-3-[[4-(3-methylbutan-2-yl)triazol-1-yl]-sulfanylmethyl]hexanamide (PubChem CID 123582866) has the molecular formula C23H36N6O3S and a molecular weight of 476.65 g/mol. Its IUPAC name is 6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-methyl-3-[[4-(3-methylbutan-2-yl)triazol-1-yl]-sulfanylmethyl]hexanamide.
| Compound Name | 6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-methyl-3-[[4-(3-methylbutan-2-yl)triazol-1-yl]-sulfanylmethyl]hexanamide |
|---|---|
| PubChem CID | 123582866 |
| Molecular Formula | C23H36N6O3S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 6-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]-2-methyl-3-[[4-(3-methylbutan-2-yl)triazol-1-yl]-sulfanylmethyl]hexanamide |
| SMILES | CC(C)C(C)c1cn(C(S)C(CCCNC(N)=O)C(C)C(=O)Nc2ccc(CO)cc2)nn1 |
| InChI | InChI=1S/C23H36N6O3S/c1-14(2)15(3)20-12-29(28-27-20)22(33)19(6-5-11-25-23(24)32)16(4)21(31)26-18-9-7-17(13-30)8-10-18/h7-10,12,14-16,19,22,30,33H,5-6,11,13H2,1-4H3,(H,26,31)(H3,24,25,32) |
| InChIKey | CBPGABBNUUFNMY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|