C23H33N7O5 — CID 146608798
prop-2-enyl N-[1-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-2-methylpropyl]carbamate (PubChem CID 146608798) has the molecular formula C23H33N7O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is prop-2-enyl N-[1-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-2-methylpropyl]carbamate.
| Compound Name | prop-2-enyl N-[1-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 146608798 |
| Molecular Formula | C23H33N7O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | prop-2-enyl N-[1-[1-[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]triazol-4-yl]-2-methylpropyl]carbamate |
| SMILES | C=CCOC(=O)NC(c1cn([C@@H](CCCNC(N)=O)C(=O)Nc2ccc(CO)cc2)nn1)C(C)C |
| InChI | InChI=1S/C23H33N7O5/c1-4-12-35-23(34)27-20(15(2)3)18-13-30(29-28-18)19(6-5-11-25-22(24)33)21(32)26-17-9-7-16(14-31)8-10-17/h4,7-10,13,15,19-20,31H,1,5-6,11-12,14H2,2-3H3,(H,26,32)(H,27,34)(H3,24,25,33)/t19-,20?/m0/s1 |
| InChIKey | BRWSYWVXXSMAAD-XJDOXCRVSA-N |
| XLogP | 2.01 |
| TPSA | 173.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|