C17H28N4O4 — CID 122577469
(2S)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]-6-(prop-2-enoxycarbonylamino)hexanoic acid (PubChem CID 122577469) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]-6-(prop-2-enoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]-6-(prop-2-enoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 122577469 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S)-2-[4-[(2S)-3-methylbutan-2-yl]triazol-1-yl]-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| SMILES | C=CCOC(=O)NCCCCC(C(=O)O)n1cc([C@@H](C)C(C)C)nn1 |
| InChI | InChI=1S/C17H28N4O4/c1-5-10-25-17(24)18-9-7-6-8-15(16(22)23)21-11-14(19-20-21)13(4)12(2)3/h5,11-13,15H,1,6-10H2,2-4H3,(H,18,24)(H,22,23)/t13-,15?/m0/s1 |
| InChIKey | NWROIYXMKRTPGK-CFMCSPIPSA-N |
| XLogP | 2.75 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|